Products 1172964-57-6
CAS 1172964-57-6 appears in our catalog under these names: 1-[(2,4-Dimethylphenyl)sulfonyl]piperazine hydrochloride, 95%, 1-(2,4-Dimethylbenzenesulfonyl)piperazine hydrochloride, 98%, 1-(2,4-Dimethylbenzenesulfonyl)piperazine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
1-(2,4-dimethylphenyl)sulfonylpiperazine;hydrochloride (CAS 1172964-57-6) is a chemical compound with the molecular formula C12H19ClN2O2S and a molecular weight of 290.81 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)sulfonylpiperazine;hydrochloride. InChIKey: NJLNJYUZIITBBA-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O2S |
|---|---|
| Molecular weight | 290.81 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)sulfonylpiperazine;hydrochloride |
| InChIKey | NJLNJYUZIITBBA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)N2CCNCC2)C.Cl |
Computed by PubChem (NCBI)