CAS 115913-32-1 appears in our catalog under these names: Dimethyl Bicyclo[1.1.1]pentane-1,3-dicarboxylate, >95.0%(GC), Dimethyl Bicyclo[1.1.1]pentane-1,3-dicarboxylate, 98%, 98%, Dimethyl bicyclo[1.1.1]pentane-1,3-dicarboxylate, 99.70%, Dimethyl bicyclo[1.1.1]pentane-1,3-dicarboxylate, 95%, 1,3-dimethyl bicyclo[1.1.1]pentane-1,3-dicarboxylate, 98%. Offered by: TCI, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
Dimethyl bicyclo[1.1.1]pentane-1,3-dicarboxylate (CAS 115913-32-1) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: dimethyl bicyclo[1.1.1]pentane-1,3-dicarboxylate. InChIKey: TWMHLEILGHXLSY-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | dimethyl bicyclo[1.1.1]pentane-1,3-dicarboxylate |
| InChIKey | TWMHLEILGHXLSY-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(C2)C(=O)OC |
Computed by PubChem (NCBI)