CAS 1159138-98-3 appears in our catalog under these names: (S)-3-Cbz-amino-3-t-butyl-propanoic Acid, (S)-3-(Benzyloxycarbonylamino)-4,4-dimethylpentanoic acid, 95%, (S)–3–(((Benzyloxy)carbonyl)amino)–4,4–dimethylpentanoic acid. Offered by: Biosynth, Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
(3S)-4,4-dimethyl-3-(phenylmethoxycarbonylamino)pentanoic acid (CAS 1159138-98-3) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (3S)-4,4-dimethyl-3-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: PAENHBDXAWYRRZ-LBPRGKRZSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (3S)-4,4-dimethyl-3-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | PAENHBDXAWYRRZ-LBPRGKRZSA-N |
| SMILES | CC(C)(C)[C@H](CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)