CAS 872423-95-5 appears in our catalog under these names: (R)-3-(Benzyloxycarbonylamino)-4,4-dimethylpentanoic acid, 95%, (R)-3-(((Benzyloxy)carbonyl)amino)-4,4-dimethylpentanoic acid, 97%, (R)–3–(((Benzyloxy)carbonyl)amino)–4,4–dimethylpentanoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg.
(3R)-4,4-dimethyl-3-(phenylmethoxycarbonylamino)pentanoic acid (CAS 872423-95-5) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (3R)-4,4-dimethyl-3-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: PAENHBDXAWYRRZ-GFCCVEGCSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (3R)-4,4-dimethyl-3-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | PAENHBDXAWYRRZ-GFCCVEGCSA-N |
| SMILES | CC(C)(C)[C@@H](CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)