CAS 1159512-71-6 is the registry number for Methyl 2-(4-bromo-3-(trifluoromethyl)phenyl)acetate, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Methyl 2-[4-bromo-3-(trifluoromethyl)phenyl]acetate (CAS 1159512-71-6) is a chemical compound with the molecular formula C10H8BrF3O2 and a molecular weight of 297.07 g/mol. IUPAC name: methyl 2-[4-bromo-3-(trifluoromethyl)phenyl]acetate. InChIKey: VNSTXVLKZHRGDY-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O2 |
|---|---|
| Molecular weight | 297.07 g/mol |
| IUPAC name | methyl 2-[4-bromo-3-(trifluoromethyl)phenyl]acetate |
| InChIKey | VNSTXVLKZHRGDY-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)