CAS 1159602-37-5 is the registry number for 4-Isoxazolemethanol, 3-(2,3-difluorophenyl)-5-methyl-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[3-(2,3-difluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol (CAS 1159602-37-5) is a chemical compound with the molecular formula C11H9F2NO2 and a molecular weight of 225.19 g/mol. IUPAC name: [3-(2,3-difluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol. InChIKey: XHSXNHQYJYFWAV-UHFFFAOYSA-N.
| Molecular formula | C11H9F2NO2 |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | [3-(2,3-difluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol |
| InChIKey | XHSXNHQYJYFWAV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C(=CC=C2)F)F)CO |
Computed by PubChem (NCBI)