Products 1335290-31-7
CAS 1335290-31-7 appears in our catalog under these names: Ethyl 2-(2-Cyanophenyl)-2,2-difluoroacetate, 95-<97%, Ethyl 2-(2-cyanophenyl)-2,2-difluoroacetate, 98%, Ethyl 2-(2-cyanophenyl)-2,2-difluoroacetate, Ethyl 2-(2-Cyanophenyl)-2,2-difluoroacetate, 98%, 98%. Offered by: Hoffman Fine Chemicals, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 0,5g, 50mg, 100mg, 250mg.
Ethyl 2-(2-cyanophenyl)-2,2-difluoroacetate (CAS 1335290-31-7) is a chemical compound with the molecular formula C11H9F2NO2 and a molecular weight of 225.19 g/mol. IUPAC name: ethyl 2-(2-cyanophenyl)-2,2-difluoroacetate. InChIKey: PFXQRKCMYVFNCF-UHFFFAOYSA-N.
| Molecular formula | C11H9F2NO2 |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | ethyl 2-(2-cyanophenyl)-2,2-difluoroacetate |
| InChIKey | PFXQRKCMYVFNCF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC=C1C#N)(F)F |
Computed by PubChem (NCBI)