CAS 202000-91-7 appears in our catalog under these names: Ethyl 2-cyano-2-(3,5-difluorophenyl)acetate, 95%, Ethyl 2-cyano-2-(3,5-difluorophenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Ethyl 2-cyano-2-(3,5-difluorophenyl)acetate (CAS 202000-91-7) is a chemical compound with the molecular formula C11H9F2NO2 and a molecular weight of 225.19 g/mol. IUPAC name: ethyl 2-cyano-2-(3,5-difluorophenyl)acetate. InChIKey: HMCJFZKHAIRFAM-UHFFFAOYSA-N.
| Molecular formula | C11H9F2NO2 |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | ethyl 2-cyano-2-(3,5-difluorophenyl)acetate |
| InChIKey | HMCJFZKHAIRFAM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)C1=CC(=CC(=C1)F)F |
Computed by PubChem (NCBI)