CAS 169674-34-4 appears in our catalog under these names: Ethyl 5,6-difluoro-1H-indole-2-carboxylate, 97%, Ethyl 5,6-difluoro-2-indolecarboxylate, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
Ethyl 5,6-difluoro-1H-indole-2-carboxylate (CAS 169674-34-4) is a chemical compound with the molecular formula C11H9F2NO2 and a molecular weight of 225.19 g/mol. IUPAC name: ethyl 5,6-difluoro-1H-indole-2-carboxylate. InChIKey: OVSOYWROLOCQIS-UHFFFAOYSA-N.
| Molecular formula | C11H9F2NO2 |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | ethyl 5,6-difluoro-1H-indole-2-carboxylate |
| InChIKey | OVSOYWROLOCQIS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=CC(=C(C=C2N1)F)F |
Computed by PubChem (NCBI)