Products 2379321-90-9
CAS 2379321-90-9 appears in our catalog under these names: 5-(6-Ethoxy-2,3-difluorophenyl)oxazole, 95%, 5-(6-ethoxy-2,3-difluorophenyl)oxazole, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg.
5-(6-ethoxy-2,3-difluorophenyl)-1,3-oxazole (CAS 2379321-90-9) is a chemical compound with the molecular formula C11H9F2NO2 and a molecular weight of 225.19 g/mol. IUPAC name: 5-(6-ethoxy-2,3-difluorophenyl)-1,3-oxazole. InChIKey: WFPLPFHEUQALCH-UHFFFAOYSA-N.
| Molecular formula | C11H9F2NO2 |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | 5-(6-ethoxy-2,3-difluorophenyl)-1,3-oxazole |
| InChIKey | WFPLPFHEUQALCH-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)F)F)C2=CN=CO2 |
Computed by PubChem (NCBI)