CAS 1159697-38-7 is the registry number for 3-(3,4-Dimethoxyphenyl)-1h-pyrazole-4-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carbonitrile (CAS 1159697-38-7) is a chemical compound with the molecular formula C12H11N3O2 and a molecular weight of 229.23 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carbonitrile. InChIKey: BHRZNAQUASSHRL-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carbonitrile |
| InChIKey | BHRZNAQUASSHRL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C=NN2)C#N)OC |
Computed by PubChem (NCBI)