CAS 175135-01-0 is the registry number for 2-Phenoxynicotinohydrazide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
2-phenoxypyridine-3-carbohydrazide (CAS 175135-01-0) is a chemical compound with the molecular formula C12H11N3O2 and a molecular weight of 229.23 g/mol. IUPAC name: 2-phenoxypyridine-3-carbohydrazide. InChIKey: LZIVTMKZXYGBTB-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 2-phenoxypyridine-3-carbohydrazide |
| InChIKey | LZIVTMKZXYGBTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=CC=N2)C(=O)NN |
Computed by PubChem (NCBI)