Products 139393-02-5
CAS 139393-02-5 appears in our catalog under these names: H-Trp(5-CN)-OH 97%, (S)-2-Amino-3-(5-cyano-1h-indol-3-yl)propanoic acid, 95%, (S)-2-Amino-3-(5-cyano-1H-indol-3-yl)propanoic Acid, (S)–2–Amino–3–(5–cyano–1H–indol–3–yl)propanoic acid, (S)-2-Amino-3-(5-cyano-1H-indol-3-yl)propanoic acid, 97%, 97%. Offered by: Ambeed, Combi-blocks, TRC, GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
(2S)-2-amino-3-(5-cyano-1H-indol-3-yl)propanoic acid (CAS 139393-02-5) is a chemical compound with the molecular formula C12H11N3O2 and a molecular weight of 229.23 g/mol. IUPAC name: (2S)-2-amino-3-(5-cyano-1H-indol-3-yl)propanoic acid. InChIKey: RWUVZHFIVNNDBO-JTQLQIEISA-N.
| Molecular formula | C12H11N3O2 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | (2S)-2-amino-3-(5-cyano-1H-indol-3-yl)propanoic acid |
| InChIKey | RWUVZHFIVNNDBO-JTQLQIEISA-N |
| SMILES | C1=CC2=C(C=C1C#N)C(=CN2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)