CAS 3723-70-4 appears in our catalog under these names: N-Benzyl-3-nitropyridin-2-amine, 97%, N-Benzyl-3-nitropyridin-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg.
N-benzyl-3-nitropyridin-2-amine (CAS 3723-70-4) is a chemical compound with the molecular formula C12H11N3O2 and a molecular weight of 229.23 g/mol. IUPAC name: N-benzyl-3-nitropyridin-2-amine. InChIKey: RBBKTZWUWVAWBV-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | N-benzyl-3-nitropyridin-2-amine |
| InChIKey | RBBKTZWUWVAWBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)