Products 2089602-82-2
CAS 2089602-82-2 appears in our catalog under these names: 5-Cyano-DL-tryptophan, min. 90 %, 50 mg, 5-Cyano-dl-tryptophan, 95%, 2-Amino-3-(5-cyano-1H-indol-3-yl)propanoic acid, 97%, 5-Cyano-DL-tryptophan, 5-Cyano-DL-tryptophan, min. 90 %, 25 mg. Offered by: Roth, Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 50mg, 100mg, 1g, 250mg, 500mg, 25mg.
2-amino-3-(5-cyano-1H-indol-3-yl)propanoic acid (CAS 2089602-82-2) is a chemical compound with the molecular formula C12H11N3O2 and a molecular weight of 229.23 g/mol. IUPAC name: 2-amino-3-(5-cyano-1H-indol-3-yl)propanoic acid. InChIKey: RWUVZHFIVNNDBO-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 2-amino-3-(5-cyano-1H-indol-3-yl)propanoic acid |
| InChIKey | RWUVZHFIVNNDBO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C(=CN2)CC(C(=O)O)N |
Computed by PubChem (NCBI)