CAS 1159818-79-7 appears in our catalog under these names: (2,4'-Bipyridin)-4-amine, 97%, (2,4'–Bipyridin)–4–amine. Offered by: AmBeed, GLPBio. Available pack sizes: 100mg, 250mg.
2-pyridin-4-ylpyridin-4-amine (CAS 1159818-79-7) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 2-pyridin-4-ylpyridin-4-amine. InChIKey: HYXAPDBMSRLKMT-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 2-pyridin-4-ylpyridin-4-amine |
| InChIKey | HYXAPDBMSRLKMT-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NC=CC(=C2)N |
Computed by PubChem (NCBI)