CAS 94512-07-9 is the registry number for 2-(3-Oxo-1,2-dihydroisoindol-1-yl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-(3-oxo-1,2-dihydroisoindol-1-yl)acetamide (CAS 94512-07-9) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 2-(3-oxo-1,2-dihydroisoindol-1-yl)acetamide. InChIKey: AJEGLPHDCIMJPT-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2-(3-oxo-1,2-dihydroisoindol-1-yl)acetamide |
| InChIKey | AJEGLPHDCIMJPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(NC2=O)CC(=O)N |
Computed by PubChem (NCBI)