CAS 1159988-50-7 is the registry number for 4-Chloro-3,5-bis(3-methoxyphenyl)-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-chloro-3,5-bis(3-methoxyphenyl)-1H-pyrazole (CAS 1159988-50-7) is a chemical compound with the molecular formula C17H15ClN2O2 and a molecular weight of 314.8 g/mol. IUPAC name: 4-chloro-3,5-bis(3-methoxyphenyl)-1H-pyrazole. InChIKey: SNPDWSBWLYODCV-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O2 |
|---|---|
| Molecular weight | 314.8 g/mol |
| IUPAC name | 4-chloro-3,5-bis(3-methoxyphenyl)-1H-pyrazole |
| InChIKey | SNPDWSBWLYODCV-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=C(C(=NN2)C3=CC(=CC=C3)OC)Cl |
Computed by PubChem (NCBI)