Products 37468-32-9
CAS 37468-32-9 appears in our catalog under these names: ALLO–1, ALLO-1. Offered by: GLPBio, TargetMol, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 1 mg.
1-benzyl-3-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione (CAS 37468-32-9) is a chemical compound with the molecular formula C17H15ClN2O2 and a molecular weight of 314.8 g/mol. IUPAC name: 1-benzyl-3-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione. InChIKey: GHAJNZREWTZYQJ-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O2 |
|---|---|
| Molecular weight | 314.8 g/mol |
| IUPAC name | 1-benzyl-3-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | GHAJNZREWTZYQJ-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(C(=O)N1CC2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)