Products 17191-70-7
CAS 17191-70-7 is the registry number for 3-Methoxy-temazepam, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
7-chloro-3-methoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one (CAS 17191-70-7) is a chemical compound with the molecular formula C17H15ClN2O2 and a molecular weight of 314.8 g/mol. IUPAC name: 7-chloro-3-methoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one. InChIKey: JVCZEDGTKACWMA-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O2 |
|---|---|
| Molecular weight | 314.8 g/mol |
| IUPAC name | 7-chloro-3-methoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| InChIKey | JVCZEDGTKACWMA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Cl)C(=NC(C1=O)OC)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
O-Methyl temazepam, O-Methyl temazepam, (RS)-, Temazepam EP Impurity D, Temazepam specified impurity D [EP], Temazepam impurity, O-methyl temazepam- [USP], 7-chloro-3-methoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one, 2H-1,4-Benzodiazepin-2-one, 7-chloro-1,3-dihydro-3-methoxy-1-methyl-5-phenyl-, 3-Methoxy-temazepam, 3-Methoxydizepam, Temazepam impurity D