CAS 93329-92-1 appears in our catalog under these names: 3-Deshydroxy-(5H)-4-methyl-3-oxo Temazepam, 3-Deshydroxy-(5H)-4-methyl-3-oxo temazepam-13C2, d6. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 10mg, 50mg.
7-chloro-1,4-dimethyl-5-phenyl-5H-1,4-benzodiazepine-2,3-dione (CAS 93329-92-1) is a chemical compound with the molecular formula C17H15ClN2O2 and a molecular weight of 314.8 g/mol. IUPAC name: 7-chloro-1,4-dimethyl-5-phenyl-5H-1,4-benzodiazepine-2,3-dione. InChIKey: WKJQSJGQLLOTCI-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O2 |
|---|---|
| Molecular weight | 314.8 g/mol |
| IUPAC name | 7-chloro-1,4-dimethyl-5-phenyl-5H-1,4-benzodiazepine-2,3-dione |
| InChIKey | WKJQSJGQLLOTCI-UHFFFAOYSA-N |
| SMILES | CN1C(C2=C(C=CC(=C2)Cl)N(C(=O)C1=O)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)