CAS 62659-64-7 appears in our catalog under these names: N-Ethyloxazepam, N-Ethyloxazepam, 1mg/ml in Methanol. Offered by: Lipomed. Available pack sizes: 50mg, 100mg, 10mg, 1ml.
7-chloro-1-ethyl-3-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-one (CAS 62659-64-7) is a chemical compound with the molecular formula C17H15ClN2O2 and a molecular weight of 314.8 g/mol. IUPAC name: 7-chloro-1-ethyl-3-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-one. InChIKey: OHSDHROCPILTFX-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O2 |
|---|---|
| Molecular weight | 314.8 g/mol |
| IUPAC name | 7-chloro-1-ethyl-3-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-one |
| InChIKey | OHSDHROCPILTFX-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)Cl)C(=NC(C1=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)