CAS 1160182-44-4 appears in our catalog under these names: 4-Bromo-3-(1,3-dioxolan-2-yl)phenol, 95%, 95%, 4-BROMO-3-(1,3-DIOXOLAN-2-YL)PHENOL, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-3-(1,3-dioxolan-2-yl)phenol (CAS 1160182-44-4) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 4-bromo-3-(1,3-dioxolan-2-yl)phenol. InChIKey: YDFPHBYVAKDDEF-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 4-bromo-3-(1,3-dioxolan-2-yl)phenol |
| InChIKey | YDFPHBYVAKDDEF-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CC(=C2)O)Br |
Computed by PubChem (NCBI)