Products 1160246-21-8

CAS 1160246-21-8 is the registry number for 2-(1-(2,2-Difluoroethyl)piperidin-4-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[1-(2,2-difluoroethyl)piperidin-4-yl]acetic acid (CAS 1160246-21-8) is a chemical compound with the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. IUPAC name: 2-[1-(2,2-difluoroethyl)piperidin-4-yl]acetic acid. InChIKey: DFUVQEJYNQRCES-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15F2NO2
Molecular weight207.22 g/mol
IUPAC name2-[1-(2,2-difluoroethyl)piperidin-4-yl]acetic acid
InChIKeyDFUVQEJYNQRCES-UHFFFAOYSA-N
SMILESC1CN(CCC1CC(=O)O)CC(F)F

Computed by PubChem (NCBI)