CAS 2136231-08-6 is the registry number for tert-Butyl (R)-4,4-difluoropyrrolidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R)-4,4-difluoropyrrolidine-2-carboxylate (CAS 2136231-08-6) is a chemical compound with the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. IUPAC name: tert-butyl (2R)-4,4-difluoropyrrolidine-2-carboxylate. InChIKey: ORKRSLURHDAZKN-ZCFIWIBFSA-N.
| Molecular formula | C9H15F2NO2 |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | tert-butyl (2R)-4,4-difluoropyrrolidine-2-carboxylate |
| InChIKey | ORKRSLURHDAZKN-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H]1CC(CN1)(F)F |
Computed by PubChem (NCBI)