CAS 1160246-95-6 appears in our catalog under these names: 8-(1,1-Dimethylethyl) 2-methyl 1-oxa-8-azaspiro[4.5]decane-2,8-dicarboxylate, 95%, 95%, 8-tert-Butyl 2-methyl 1-oxa-8-azaspiro-(4.5)decane-2,8-dicarboxylate, 98+%, 8-TERT-BUTYL 2-METHYL 1-OXA-8-AZASPIRO[4.5]DECANE-2,8-DICARBOXYLATE, 95%. Offered by: Chemat, AmBeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g.
8-O-tert-butyl 2-O-methyl 1-oxa-8-azaspiro[4.5]decane-2,8-dicarboxylate (CAS 1160246-95-6) is a chemical compound with the molecular formula C15H25NO5 and a molecular weight of 299.36 g/mol. IUPAC name: 8-O-tert-butyl 2-O-methyl 1-oxa-8-azaspiro[4.5]decane-2,8-dicarboxylate. InChIKey: AAKXXTYECWMWHH-UHFFFAOYSA-N.
| Molecular formula | C15H25NO5 |
|---|---|
| Molecular weight | 299.36 g/mol |
| IUPAC name | 8-O-tert-butyl 2-O-methyl 1-oxa-8-azaspiro[4.5]decane-2,8-dicarboxylate |
| InChIKey | AAKXXTYECWMWHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(O2)C(=O)OC)CC1 |
Computed by PubChem (NCBI)