Products 1160249-25-1
CAS 1160249-25-1 appears in our catalog under these names: 4,5,6,7,8,9-Hexahydrocycloocta[b]thiophene-2-carbonyl chloride, 95%, 4,5,6,7,8,9-Hexahydrocycloocta(b)thiophene-2-carbonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl chloride (CAS 1160249-25-1) is a chemical compound with the molecular formula C11H13ClOS and a molecular weight of 228.74 g/mol. IUPAC name: 4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl chloride. InChIKey: ROHVXDURUHBXHM-UHFFFAOYSA-N.
| Molecular formula | C11H13ClOS |
|---|---|
| Molecular weight | 228.74 g/mol |
| IUPAC name | 4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl chloride |
| InChIKey | ROHVXDURUHBXHM-UHFFFAOYSA-N |
| SMILES | C1CCCC2=C(CC1)C=C(S2)C(=O)Cl |
Computed by PubChem (NCBI)