CAS 1221171-44-3 is the registry number for 1-[(1-Chlorocyclobutyl)sulfinyl]-4-methylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
1-(1-chlorocyclobutyl)sulfinyl-4-methylbenzene (CAS 1221171-44-3) is a chemical compound with the molecular formula C11H13ClOS and a molecular weight of 228.74 g/mol. IUPAC name: 1-(1-chlorocyclobutyl)sulfinyl-4-methylbenzene. InChIKey: LKIJGSBUPSBDQN-UHFFFAOYSA-N.
| Molecular formula | C11H13ClOS |
|---|---|
| Molecular weight | 228.74 g/mol |
| IUPAC name | 1-(1-chlorocyclobutyl)sulfinyl-4-methylbenzene |
| InChIKey | LKIJGSBUPSBDQN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)C2(CCC2)Cl |
Computed by PubChem (NCBI)