CAS 65006-99-7 is the registry number for [(1-Chloro-2,2-dimethylcyclopropyl)sulfinylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
(1-chloro-2,2-dimethylcyclopropyl)sulfinylbenzene (CAS 65006-99-7) is a chemical compound with the molecular formula C11H13ClOS and a molecular weight of 228.74 g/mol. IUPAC name: (1-chloro-2,2-dimethylcyclopropyl)sulfinylbenzene. InChIKey: LDYHZLISFHJPKZ-UHFFFAOYSA-N.
| Molecular formula | C11H13ClOS |
|---|---|
| Molecular weight | 228.74 g/mol |
| IUPAC name | (1-chloro-2,2-dimethylcyclopropyl)sulfinylbenzene |
| InChIKey | LDYHZLISFHJPKZ-UHFFFAOYSA-N |
| SMILES | CC1(CC1(S(=O)C2=CC=CC=C2)Cl)C |
Computed by PubChem (NCBI)