CAS 869947-17-1 appears in our catalog under these names: 5-Ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride, 95%, 5-Ethyl-4,5,6,7-tetrahydrobenzo(b)thiophene-2-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride (CAS 869947-17-1) is a chemical compound with the molecular formula C11H13ClOS and a molecular weight of 228.74 g/mol. IUPAC name: 5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride. InChIKey: CIADOBQJUAUMFH-UHFFFAOYSA-N.
| Molecular formula | C11H13ClOS |
|---|---|
| Molecular weight | 228.74 g/mol |
| IUPAC name | 5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride |
| InChIKey | CIADOBQJUAUMFH-UHFFFAOYSA-N |
| SMILES | CCC1CCC2=C(C1)C=C(S2)C(=O)Cl |
Computed by PubChem (NCBI)