CAS 97986-06-6 is the registry number for O-(3-(tert-Butyl)phenyl) carbonochloridothioate, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
O-(3-tert-butylphenyl) chloromethanethioate (CAS 97986-06-6) is a chemical compound with the molecular formula C11H13ClOS and a molecular weight of 228.74 g/mol. IUPAC name: O-(3-tert-butylphenyl) chloromethanethioate. InChIKey: RVFDGINAGFKENO-UHFFFAOYSA-N.
| Molecular formula | C11H13ClOS |
|---|---|
| Molecular weight | 228.74 g/mol |
| IUPAC name | O-(3-tert-butylphenyl) chloromethanethioate |
| InChIKey | RVFDGINAGFKENO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC=C1)OC(=S)Cl |
Computed by PubChem (NCBI)