Products 97986-06-6

CAS 97986-06-6 is the registry number for O-(3-(tert-Butyl)phenyl) carbonochloridothioate, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

O-(3-tert-butylphenyl) chloromethanethioate (CAS 97986-06-6) is a chemical compound with the molecular formula C11H13ClOS and a molecular weight of 228.74 g/mol. IUPAC name: O-(3-tert-butylphenyl) chloromethanethioate. InChIKey: RVFDGINAGFKENO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClOS
Molecular weight228.74 g/mol
IUPAC nameO-(3-tert-butylphenyl) chloromethanethioate
InChIKeyRVFDGINAGFKENO-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC(=CC=C1)OC(=S)Cl

Computed by PubChem (NCBI)