Products 1160262-47-4
CAS 1160262-47-4 appears in our catalog under these names: 4-Methoxy-2-phenyl-5-thiazolecarboxylic acid, 97%, 4-Methoxy-2-phenylthiazole-5-carboxylic acid, 97%, 4-Methoxy-2-phenylthiazole-5-carboxylic acid, 97%, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-methoxy-2-phenyl-1,3-thiazole-5-carboxylic acid (CAS 1160262-47-4) is a chemical compound with the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. IUPAC name: 4-methoxy-2-phenyl-1,3-thiazole-5-carboxylic acid. InChIKey: BQWBKWFGEHJXHK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 4-methoxy-2-phenyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | BQWBKWFGEHJXHK-UHFFFAOYSA-N |
| SMILES | COC1=C(SC(=N1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)