CAS 1160574-03-7 is the registry number for 3,6-Dibromo-2-fluorobenzonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3,6-dibromo-2-fluorobenzonitrile (CAS 1160574-03-7) is a chemical compound with the molecular formula C7H2Br2FN and a molecular weight of 278.90 g/mol. IUPAC name: 3,6-dibromo-2-fluorobenzonitrile. InChIKey: DZMCHPIKZPLJQF-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2FN |
|---|---|
| Molecular weight | 278.90 g/mol |
| IUPAC name | 3,6-dibromo-2-fluorobenzonitrile |
| InChIKey | DZMCHPIKZPLJQF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Br)C#N)F)Br |
Computed by PubChem (NCBI)