CAS 1805122-97-7 is the registry number for 2,3-dibromo-6-fluorobenzonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,3-dibromo-6-fluorobenzonitrile (CAS 1805122-97-7) is a chemical compound with the molecular formula C7H2Br2FN and a molecular weight of 278.90 g/mol. IUPAC name: 2,3-dibromo-6-fluorobenzonitrile. InChIKey: TVCNHHCDDRLISA-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2FN |
|---|---|
| Molecular weight | 278.90 g/mol |
| IUPAC name | 2,3-dibromo-6-fluorobenzonitrile |
| InChIKey | TVCNHHCDDRLISA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C#N)Br)Br |
Computed by PubChem (NCBI)