CAS 1806353-46-7 is the registry number for 2,5-Dibromo-3-fluorobenzonitrile, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,5-dibromo-3-fluorobenzonitrile (CAS 1806353-46-7) is a chemical compound with the molecular formula C7H2Br2FN and a molecular weight of 278.90 g/mol. IUPAC name: 2,5-dibromo-3-fluorobenzonitrile. InChIKey: QHLPCUKCVZTGNI-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2FN |
|---|---|
| Molecular weight | 278.90 g/mol |
| IUPAC name | 2,5-dibromo-3-fluorobenzonitrile |
| InChIKey | QHLPCUKCVZTGNI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)Br)F)Br |
Computed by PubChem (NCBI)