CAS 1379326-67-6 appears in our catalog under these names: 2,5–Dibromo–4–fluorobenzonitrile, 2,5-Dibromo-4-fluorobenzonitrile 97%, 2,5-Dibromo-4-Fluorobenzonitrile, 97%, 97%, 2,5-Dibromo-4-fluorobenzonitrile, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2,5-dibromo-4-fluorobenzonitrile (CAS 1379326-67-6) is a chemical compound with the molecular formula C7H2Br2FN and a molecular weight of 278.90 g/mol. IUPAC name: 2,5-dibromo-4-fluorobenzonitrile. InChIKey: KSJPHKSCOBGZQL-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2FN |
|---|---|
| Molecular weight | 278.90 g/mol |
| IUPAC name | 2,5-dibromo-4-fluorobenzonitrile |
| InChIKey | KSJPHKSCOBGZQL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)Br)C#N |
Computed by PubChem (NCBI)