CAS 1160574-05-9 is the registry number for 3,5-Dibromo-2-fluorobenzonitrile, 97%. Offered by: AmBeed. Available pack sizes: 5g.
3,5-dibromo-2-fluorobenzonitrile (CAS 1160574-05-9) is a chemical compound with the molecular formula C7H2Br2FN and a molecular weight of 278.90 g/mol. IUPAC name: 3,5-dibromo-2-fluorobenzonitrile. InChIKey: FGPDDOQNFYELRS-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2FN |
|---|---|
| Molecular weight | 278.90 g/mol |
| IUPAC name | 3,5-dibromo-2-fluorobenzonitrile |
| InChIKey | FGPDDOQNFYELRS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)F)Br)Br |
Computed by PubChem (NCBI)