CAS 1161362-01-1 appears in our catalog under these names: 3-Bromo-5-(trifluoromethyl)phenylacetic acid, 97%, 97%, 3-Bromo-5-(trifluoromethyl)phenylacetic acid, 97%, 3-Bromo-5-(trifluoromethyl)phenylacetic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
2-[3-bromo-5-(trifluoromethyl)phenyl]acetic acid (CAS 1161362-01-1) is a chemical compound with the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. IUPAC name: 2-[3-bromo-5-(trifluoromethyl)phenyl]acetic acid. InChIKey: POLZAYSCKXDHKM-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O2 |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | 2-[3-bromo-5-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | POLZAYSCKXDHKM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)Br)CC(=O)O |
Computed by PubChem (NCBI)