CAS 116272-75-4 is the registry number for (E)-1-bromo-3-(2-nitroprop-1-en-1-yl)benzene, 97% mix TBC as stabilizer. Offered by: AmBeed. Available pack sizes: 1g.
1-bromo-3-[(E)-2-nitroprop-1-enyl]benzene (CAS 116272-75-4) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 1-bromo-3-[(E)-2-nitroprop-1-enyl]benzene. InChIKey: YIYKNVSMWCPXES-FNORWQNLSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 1-bromo-3-[(E)-2-nitroprop-1-enyl]benzene |
| InChIKey | YIYKNVSMWCPXES-FNORWQNLSA-N |
| SMILES | C/C(=C\C1=CC(=CC=C1)Br)/[N+](=O)[O-] |
Computed by PubChem (NCBI)