Products 116435-84-8
CAS 116435-84-8 appears in our catalog under these names: Dapsone Impurity 5, Dapsone Impurity 10, Dapsone Impurity 13, 2,4-Diaminophenyl Sulfone. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-(benzenesulfonyl)benzene-1,3-diamine (CAS 116435-84-8) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: 4-(benzenesulfonyl)benzene-1,3-diamine. InChIKey: XFGDOQVDCBRDDP-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | 4-(benzenesulfonyl)benzene-1,3-diamine |
| InChIKey | XFGDOQVDCBRDDP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=C(C=C(C=C2)N)N |
Computed by PubChem (NCBI)