CAS 1164564-37-7 is the registry number for 4-(2,4-Difluorophenoxy)-1-(dimethylamino)-1-penten-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-4-(2,4-difluorophenoxy)-1-(dimethylamino)pent-1-en-3-one (CAS 1164564-37-7) is a chemical compound with the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. IUPAC name: (E)-4-(2,4-difluorophenoxy)-1-(dimethylamino)pent-1-en-3-one. InChIKey: LVWFDPFROZPTCW-VOTSOKGWSA-N.
| Molecular formula | C13H15F2NO2 |
|---|---|
| Molecular weight | 255.26 g/mol |
| IUPAC name | (E)-4-(2,4-difluorophenoxy)-1-(dimethylamino)pent-1-en-3-one |
| InChIKey | LVWFDPFROZPTCW-VOTSOKGWSA-N |
| SMILES | CC(C(=O)/C=C/N(C)C)OC1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)