Products 919800-25-2
CAS 919800-25-2 is the registry number for 1,3-Benzodioxol-5-amine, n-(cyclopentylmethyl)-2,2-difluoro-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-(cyclopentylmethyl)-2,2-difluoro-1,3-benzodioxol-5-amine (CAS 919800-25-2) is a chemical compound with the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. IUPAC name: N-(cyclopentylmethyl)-2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: SHNYYWIEUOPULX-UHFFFAOYSA-N.
| Molecular formula | C13H15F2NO2 |
|---|---|
| Molecular weight | 255.26 g/mol |
| IUPAC name | N-(cyclopentylmethyl)-2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | SHNYYWIEUOPULX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)CNC2=CC3=C(C=C2)OC(O3)(F)F |
Computed by PubChem (NCBI)