CAS 259110-56-0 is the registry number for Rel-benzyl (3R,5S)-3,5-difluoropiperidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (3R,5S)-3,5-difluoropiperidine-1-carboxylate (CAS 259110-56-0) is a chemical compound with the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. IUPAC name: benzyl (3R,5S)-3,5-difluoropiperidine-1-carboxylate. InChIKey: DCFSHDWSTOGHKY-TXEJJXNPSA-N.
| Molecular formula | C13H15F2NO2 |
|---|---|
| Molecular weight | 255.26 g/mol |
| IUPAC name | benzyl (3R,5S)-3,5-difluoropiperidine-1-carboxylate |
| InChIKey | DCFSHDWSTOGHKY-TXEJJXNPSA-N |
| SMILES | C1[C@H](CN(C[C@H]1F)C(=O)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)