Products 2227835-98-3
CAS 2227835-98-3 appears in our catalog under these names: Trans–ethyl –4–(3，4–difluorophenyl)pyrrolidine–3–carboxylate hydrochloride, rac-ethyl (3R,4S)-4-(3,4-difluorophenyl)pyrrolidine-3-carboxylate. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
Ethyl (3S,4R)-4-(3,4-difluorophenyl)pyrrolidine-3-carboxylate (CAS 2227835-98-3) is a chemical compound with the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. IUPAC name: ethyl (3S,4R)-4-(3,4-difluorophenyl)pyrrolidine-3-carboxylate. InChIKey: LDHPXUKZVWZBGX-VHSXEESVSA-N.
| Molecular formula | C13H15F2NO2 |
|---|---|
| Molecular weight | 255.26 g/mol |
| IUPAC name | ethyl (3S,4R)-4-(3,4-difluorophenyl)pyrrolidine-3-carboxylate |
| InChIKey | LDHPXUKZVWZBGX-VHSXEESVSA-N |
| SMILES | CCOC(=O)[C@@H]1CNC[C@H]1C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)