CAS 2760790-51-8 is the registry number for Methyl (S)-4-(4,4-difluoropiperidin-2-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-[(2S)-4,4-difluoropiperidin-2-yl]benzoate (CAS 2760790-51-8) is a chemical compound with the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. IUPAC name: methyl 4-[(2S)-4,4-difluoropiperidin-2-yl]benzoate. InChIKey: KJCPNUPKOJMSGG-NSHDSACASA-N.
| Molecular formula | C13H15F2NO2 |
|---|---|
| Molecular weight | 255.26 g/mol |
| IUPAC name | methyl 4-[(2S)-4,4-difluoropiperidin-2-yl]benzoate |
| InChIKey | KJCPNUPKOJMSGG-NSHDSACASA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)[C@@H]2CC(CCN2)(F)F |
Computed by PubChem (NCBI)