CAS 116686-84-1 appears in our catalog under these names: 1-(3-Chloro-4-nitrophenyl)ethan-1-one, ≥97%, 1-(3-Chloro-4-nitrophenyl)ethanone, ≥97%, ≥97%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(3-chloro-4-nitrophenyl)ethanone (CAS 116686-84-1) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 1-(3-chloro-4-nitrophenyl)ethanone. InChIKey: GLWASYDLRWSDQJ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 1-(3-chloro-4-nitrophenyl)ethanone |
| InChIKey | GLWASYDLRWSDQJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)