Products 17738-71-5

CAS 17738-71-5 appears in our catalog under these names: [(4-Chlorophenyl)amino](oxo)acetic acid, 95%, ((4-Chlorophenyl)amino)(oxo)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(4-chloroanilino)-2-oxoacetic acid (CAS 17738-71-5) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 2-(4-chloroanilino)-2-oxoacetic acid. InChIKey: SGVMYQGWSLUOHH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClNO3
Molecular weight199.59 g/mol
IUPAC name2-(4-chloroanilino)-2-oxoacetic acid
InChIKeySGVMYQGWSLUOHH-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1NC(=O)C(=O)O)Cl

Computed by PubChem (NCBI)