Products 50434-36-1
CAS 50434-36-1 appears in our catalog under these names: 2-(4-Nitrophenyl)acetyl chloride, 95%, 2-(4-Nitrophenyl)acetyl chloride, 97%, 4-Nitro-benzeneacetyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g, 10000mg, 5000mg.
2-(4-nitrophenyl)acetyl chloride (CAS 50434-36-1) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 2-(4-nitrophenyl)acetyl chloride. InChIKey: FYXZTVPBFJQFBO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 2-(4-nitrophenyl)acetyl chloride |
| InChIKey | FYXZTVPBFJQFBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-(4-nitrophenyl)acetyl chloride, Benzeneacetyl chloride, 4-nitro-, 4-Nitrobenzeneacetyl chloride, (4-nitrophenyl)acetyl chloride, 2-(4-nitrophenyl)acetylchloride, p-Nitrophenylacetylchloride, p-nitrophenylacetyl chloride, 4-nitrophenylacetyl chloride, 4-Nitro-benzeneacetyl chloride, 4-nitrophenylacetic acid chloride