Products 1314040-69-1

CAS 1314040-69-1 is the registry number for 4-Acetyl-6-chloronicotinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

4-acetyl-6-chloropyridine-3-carboxylic acid (CAS 1314040-69-1) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 4-acetyl-6-chloropyridine-3-carboxylic acid. InChIKey: GIIKBGQRPFHVIH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClNO3
Molecular weight199.59 g/mol
IUPAC name4-acetyl-6-chloropyridine-3-carboxylic acid
InChIKeyGIIKBGQRPFHVIH-UHFFFAOYSA-N
SMILESCC(=O)C1=CC(=NC=C1C(=O)O)Cl

Computed by PubChem (NCBI)