Products 66232-57-3
CAS 66232-57-3 appears in our catalog under these names: 2-Methyl-6-nitrobenzoyl chloride, 95%, 2-Methyl-6-nitrobenzoylchloride, 98%, 2–Methyl–6–nitrobenzoyl Chloride, 2-Methyl-6-nitrobenzoyl Chloride, 98%(GC-MS),RG, 98%(GC-MS),RG, 2-methyl-6-nitrobenzoyl chloride, 98%(GC-MS),RG. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
2-methyl-6-nitrobenzoyl chloride (CAS 66232-57-3) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 2-methyl-6-nitrobenzoyl chloride. InChIKey: ZMAJSTDJAIVHGZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 2-methyl-6-nitrobenzoyl chloride |
| InChIKey | ZMAJSTDJAIVHGZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)